C18H14N2O4Se — CID 51032935
benzyl N,N'-bis(furan-2-carbonyl)carbamimidoselenoate (PubChem CID 51032935) has the molecular formula C18H14N2O4Se and a molecular weight of 401.28 g/mol. Its IUPAC name is benzyl N,N'-bis(furan-2-carbonyl)carbamimidoselenoate.
| Compound Name | benzyl N,N'-bis(furan-2-carbonyl)carbamimidoselenoate |
|---|---|
| PubChem CID | 51032935 |
| Molecular Formula | C18H14N2O4Se |
| Molecular Weight | 401.28 g/mol |
| Exact Mass | 402.01 |
| IUPAC Name | benzyl N,N'-bis(furan-2-carbonyl)carbamimidoselenoate |
| SMILES | O=C(/N=C(\NC(=O)c1ccco1)[Se]Cc1ccccc1)c1ccco1 |
| InChI | InChI=1S/C18H14N2O4Se/c21-16(14-8-4-10-23-14)19-18(20-17(22)15-9-5-11-24-15)25-12-13-6-2-1-3-7-13/h1-11H,12H2,(H,19,20,21,22) |
| InChIKey | XOTZBZRECHMAST-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 84.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.28 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|