About N-(diphenyl-λ4-sulfanylidene)furan-2-carboxamide
N-(diphenyl-λ4-sulfanylidene)furan-2-carboxamide (PubChem CID 5057066) has the molecular formula C17H13NO2S
and a molecular weight of 295.36 g/mol. Its IUPAC name is N-(diphenyl-λ4-sulfanylidene)furan-2-carboxamide.
Molecular Properties
| Compound Name | N-(diphenyl-λ4-sulfanylidene)furan-2-carboxamide |
| PubChem CID | 5057066 |
| Molecular Formula | C17H13NO2S |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.07 |
| IUPAC Name | N-(diphenyl-λ4-sulfanylidene)furan-2-carboxamide |
| SMILES | O=C(N=S(c1ccccc1)c1ccccc1)c1ccco1 |
| InChI | InChI=1S/C17H13NO2S/c19-17(16-12-7-13-20-16)18-21(14-8-3-1-4-9-14)15-10-5-2-6-11-15/h1-13H |
| InChIKey | CLJPGLNQLWDUHD-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 42.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(diphenyl-λ4-sulfanylidene)furan-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(diphenyl-λ4-sulfanylidene)furan-2-carboxamide?
The IUPAC name of N-(diphenyl-λ4-sulfanylidene)furan-2-carboxamide (CID 5057066) is N-(diphenyl-λ4-sulfanylidene)furan-2-carboxamide.
What is the SMILES notation for N-(diphenyl-λ4-sulfanylidene)furan-2-carboxamide?
The canonical SMILES for N-(diphenyl-λ4-sulfanylidene)furan-2-carboxamide is O=C(N=S(c1ccccc1)c1ccccc1)c1ccco1.
What is the InChIKey of N-(diphenyl-λ4-sulfanylidene)furan-2-carboxamide?
The InChIKey is CLJPGLNQLWDUHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13NO2S/c19-17(16-12-7-13-20-16)18-21(14-8-3-1-4-9-14)15-10-5-2-6-11-15/h1-13H.
What are the key properties of N-(diphenyl-λ4-sulfanylidene)furan-2-carboxamide?
N-(diphenyl-λ4-sulfanylidene)furan-2-carboxamide has a molecular weight of 295.36 g/mol, XLogP of 4.34, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(diphenyl-λ4-sulfanylidene)furan-2-carboxamide is sourced from PubChem (CID 5057066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).