About cesium furan-2-carboxylate
cesium furan-2-carboxylate (PubChem CID 140900702) has the molecular formula C5H3CsO3
and a molecular weight of 243.98 g/mol. Its IUPAC name is cesium furan-2-carboxylate.
Molecular Properties
| Compound Name | cesium furan-2-carboxylate |
| PubChem CID | 140900702 |
| Molecular Formula | C5H3CsO3 |
| Molecular Weight | 243.98 g/mol |
| Exact Mass | 243.91 |
| IUPAC Name | cesium furan-2-carboxylate |
| SMILES | O=C([O-])c1ccco1.[Cs+] |
| InChI | InChI=1S/C5H4O3.Cs/c6-5(7)4-2-1-3-8-4;/h1-3H,(H,6,7);/q;+1/p-1 |
| InChIKey | CKFRRDULRPAXQT-UHFFFAOYSA-M |
| XLogP | -3.35 |
| TPSA | 53.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.98 |
| LogP ≤ 5 | -3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cesium furan-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cesium furan-2-carboxylate?
The IUPAC name of cesium furan-2-carboxylate (CID 140900702) is cesium furan-2-carboxylate.
What is the SMILES notation for cesium furan-2-carboxylate?
The canonical SMILES for cesium furan-2-carboxylate is O=C([O-])c1ccco1.[Cs+].
What is the InChIKey of cesium furan-2-carboxylate?
The InChIKey is CKFRRDULRPAXQT-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H4O3.Cs/c6-5(7)4-2-1-3-8-4;/h1-3H,(H,6,7);/q;+1/p-1.
What are the key properties of cesium furan-2-carboxylate?
cesium furan-2-carboxylate has a molecular weight of 243.98 g/mol, XLogP of -3.35, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cesium furan-2-carboxylate is sourced from PubChem (CID 140900702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).