About sodium furan-2-carboxylate
sodium furan-2-carboxylate (PubChem CID 19205589) has the molecular formula C5H3NaO3
and a molecular weight of 134.07 g/mol. Its IUPAC name is sodium furan-2-carboxylate.
Molecular Properties
| Compound Name | sodium furan-2-carboxylate |
| PubChem CID | 19205589 |
| Molecular Formula | C5H3NaO3 |
| Molecular Weight | 134.07 g/mol |
| Exact Mass | 134.00 |
| IUPAC Name | sodium furan-2-carboxylate |
| SMILES | O=C([O-])c1ccco1.[Na+] |
| InChI | InChI=1S/C5H4O3.Na/c6-5(7)4-2-1-3-8-4;/h1-3H,(H,6,7);/q;+1/p-1 |
| InChIKey | HDCRDACZYDHUQX-UHFFFAOYSA-M |
| XLogP | -3.35 |
| TPSA | 53.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.07 |
| LogP ≤ 5 | -3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze sodium furan-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium furan-2-carboxylate?
The IUPAC name of sodium furan-2-carboxylate (CID 19205589) is sodium furan-2-carboxylate.
What is the SMILES notation for sodium furan-2-carboxylate?
The canonical SMILES for sodium furan-2-carboxylate is O=C([O-])c1ccco1.[Na+].
What is the InChIKey of sodium furan-2-carboxylate?
The InChIKey is HDCRDACZYDHUQX-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H4O3.Na/c6-5(7)4-2-1-3-8-4;/h1-3H,(H,6,7);/q;+1/p-1.
What are the key properties of sodium furan-2-carboxylate?
sodium furan-2-carboxylate has a molecular weight of 134.07 g/mol, XLogP of -3.35, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium furan-2-carboxylate is sourced from PubChem (CID 19205589), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).