C16H26N3O4+ — CID 7301471
2-methoxyethyl N'-(furan-2-carbonyl)-N-methyl-N-(1-methylpiperidin-1-ium-4-yl)carbamimidate (PubChem CID 7301471) has the molecular formula C16H26N3O4+ and a molecular weight of 324.40 g/mol. Its IUPAC name is 2-methoxyethyl N'-(furan-2-carbonyl)-N-methyl-N-(1-methylpiperidin-1-ium-4-yl)carbamimidate.
| Compound Name | 2-methoxyethyl N'-(furan-2-carbonyl)-N-methyl-N-(1-methylpiperidin-1-ium-4-yl)carbamimidate |
|---|---|
| PubChem CID | 7301471 |
| Molecular Formula | C16H26N3O4+ |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.19 |
| IUPAC Name | 2-methoxyethyl N'-(furan-2-carbonyl)-N-methyl-N-(1-methylpiperidin-1-ium-4-yl)carbamimidate |
| SMILES | COCCO/C(=N\C(=O)c1ccco1)N(C)C1CC[NH+](C)CC1 |
| InChI | InChI=1S/C16H25N3O4/c1-18-8-6-13(7-9-18)19(2)16(23-12-11-21-3)17-15(20)14-5-4-10-22-14/h4-5,10,13H,6-9,11-12H2,1-3H3/p+1/b17-16- |
| InChIKey | GNNNNEDEGHLVQW-MSUUIHNZSA-O |
| XLogP | 0.05 |
| TPSA | 68.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.40 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|