About 2-ethoxyethyl N'-(3-methoxybenzoyl)-N-methyl-N-(1-methylpiperidin-1-ium-4-yl)carbamimidate
2-ethoxyethyl N'-(3-methoxybenzoyl)-N-methyl-N-(1-methylpiperidin-1-ium-4-yl)carbamimidate (PubChem CID 7440045) has the molecular formula C20H32N3O4+
and a molecular weight of 378.49 g/mol. Its IUPAC name is 2-ethoxyethyl N'-(3-methoxybenzoyl)-N-methyl-N-(1-methylpiperidin-1-ium-4-yl)carbamimidate.
Molecular Properties
| Compound Name | 2-ethoxyethyl N'-(3-methoxybenzoyl)-N-methyl-N-(1-methylpiperidin-1-ium-4-yl)carbamimidate |
| PubChem CID | 7440045 |
| Molecular Formula | C20H32N3O4+ |
| Molecular Weight | 378.49 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | 2-ethoxyethyl N'-(3-methoxybenzoyl)-N-methyl-N-(1-methylpiperidin-1-ium-4-yl)carbamimidate |
| SMILES | CCOCCO/C(=N\C(=O)c1cccc(OC)c1)N(C)C1CC[NH+](C)CC1 |
| InChI | InChI=1S/C20H31N3O4/c1-5-26-13-14-27-20(23(3)17-9-11-22(2)12-10-17)21-19(24)16-7-6-8-18(15-16)25-4/h6-8,15,17H,5,9-14H2,1-4H3/p+1/b21-20- |
| InChIKey | DZSDXTQCYYVYBR-MRCUWXFGSA-O |
| XLogP | 0.85 |
| TPSA | 64.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.49 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-ethoxyethyl N'-(3-methoxybenzoyl)-N-methyl-N-(1-methylpiperidin-1-ium-4-yl)carbamimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxyethyl N'-(3-methoxybenzoyl)-N-methyl-N-(1-methylpiperidin-1-ium-4-yl)carbamimidate?
The IUPAC name of 2-ethoxyethyl N'-(3-methoxybenzoyl)-N-methyl-N-(1-methylpiperidin-1-ium-4-yl)carbamimidate (CID 7440045) is 2-ethoxyethyl N'-(3-methoxybenzoyl)-N-methyl-N-(1-methylpiperidin-1-ium-4-yl)carbamimidate.
What is the SMILES notation for 2-ethoxyethyl N'-(3-methoxybenzoyl)-N-methyl-N-(1-methylpiperidin-1-ium-4-yl)carbamimidate?
The canonical SMILES for 2-ethoxyethyl N'-(3-methoxybenzoyl)-N-methyl-N-(1-methylpiperidin-1-ium-4-yl)carbamimidate is CCOCCO/C(=N\C(=O)c1cccc(OC)c1)N(C)C1CC[NH+](C)CC1.
What is the InChIKey of 2-ethoxyethyl N'-(3-methoxybenzoyl)-N-methyl-N-(1-methylpiperidin-1-ium-4-yl)carbamimidate?
The InChIKey is DZSDXTQCYYVYBR-MRCUWXFGSA-O. The full InChI is InChI=1S/C20H31N3O4/c1-5-26-13-14-27-20(23(3)17-9-11-22(2)12-10-17)21-19(24)16-7-6-8-18(15-16)25-4/h6-8,15,17H,5,9-14H2,1-4H3/p+1/b21-20-.
What are the key properties of 2-ethoxyethyl N'-(3-methoxybenzoyl)-N-methyl-N-(1-methylpiperidin-1-ium-4-yl)carbamimidate?
2-ethoxyethyl N'-(3-methoxybenzoyl)-N-methyl-N-(1-methylpiperidin-1-ium-4-yl)carbamimidate has a molecular weight of 378.49 g/mol, XLogP of 0.85, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxyethyl N'-(3-methoxybenzoyl)-N-methyl-N-(1-methylpiperidin-1-ium-4-yl)carbamimidate is sourced from PubChem (CID 7440045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).