C10H13ClN2O2 — CID 137261811
2-(1-chloroethyl)-7,7-dimethyl-3,5-dihydrofuro[3,4-d]pyrimidin-4-one (PubChem CID 137261811) has the molecular formula C10H13ClN2O2 and a molecular weight of 228.68 g/mol. Its IUPAC name is 2-(1-chloroethyl)-7,7-dimethyl-3,5-dihydrofuro[3,4-d]pyrimidin-4-one.
| Compound Name | 2-(1-chloroethyl)-7,7-dimethyl-3,5-dihydrofuro[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 137261811 |
| Molecular Formula | C10H13ClN2O2 |
| Molecular Weight | 228.68 g/mol |
| Exact Mass | 228.07 |
| IUPAC Name | 2-(1-chloroethyl)-7,7-dimethyl-3,5-dihydrofuro[3,4-d]pyrimidin-4-one |
| SMILES | CC(Cl)c1nc2c(c(=O)[nH]1)COC2(C)C |
| InChI | InChI=1S/C10H13ClN2O2/c1-5(11)8-12-7-6(9(14)13-8)4-15-10(7,2)3/h5H,4H2,1-3H3,(H,12,13,14) |
| InChIKey | QSWKCRLGLJDKKT-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.68 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|