C23H30N2O5Si — CID 137267134
5-methoxy-2-[C-phenyl-N-[3-(2,8,9-trioxa-5-aza-1-silabicyclo[3.3.3]undecan-1-yl)propyl]carbonimidoyl]phenol (PubChem CID 137267134) has the molecular formula C23H30N2O5Si and a molecular weight of 442.59 g/mol. Its IUPAC name is 5-methoxy-2-[C-phenyl-N-[3-(2,8,9-trioxa-5-aza-1-silabicyclo[3.3.3]undecan-1-yl)propyl]carbonimidoyl]phenol.
| Compound Name | 5-methoxy-2-[C-phenyl-N-[3-(2,8,9-trioxa-5-aza-1-silabicyclo[3.3.3]undecan-1-yl)propyl]carbonimidoyl]phenol |
|---|---|
| PubChem CID | 137267134 |
| Molecular Formula | C23H30N2O5Si |
| Molecular Weight | 442.59 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | 5-methoxy-2-[C-phenyl-N-[3-(2,8,9-trioxa-5-aza-1-silabicyclo[3.3.3]undecan-1-yl)propyl]carbonimidoyl]phenol |
| SMILES | COc1ccc(/C(=N/CCC[Si]23OCCN(CCO2)CCO3)c2ccccc2)c(O)c1 |
| InChI | InChI=1S/C23H30N2O5Si/c1-27-20-8-9-21(22(26)18-20)23(19-6-3-2-4-7-19)24-10-5-17-31-28-14-11-25(12-15-29-31)13-16-30-31/h2-4,6-9,18,26H,5,10-17H2,1H3/b24-23+ |
| InChIKey | QECGLGILRFBJDB-WCWDXBQESA-N |
| XLogP | 2.95 |
| TPSA | 72.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.59 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|