C15H16N4O3 — CID 137268654
butyl 4-[(6-methylidene-3-oxo-1,2,4-triazin-5-ylidene)amino]benzoate (PubChem CID 137268654) has the molecular formula C15H16N4O3 and a molecular weight of 300.32 g/mol. Its IUPAC name is butyl 4-[(6-methylidene-3-oxo-1,2,4-triazin-5-ylidene)amino]benzoate.
| Compound Name | butyl 4-[(6-methylidene-3-oxo-1,2,4-triazin-5-ylidene)amino]benzoate |
|---|---|
| PubChem CID | 137268654 |
| Molecular Formula | C15H16N4O3 |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | butyl 4-[(6-methylidene-3-oxo-1,2,4-triazin-5-ylidene)amino]benzoate |
| SMILES | C=C1N=NC(=O)N/C1=N\c1ccc(C(=O)OCCCC)cc1 |
| InChI | InChI=1S/C15H16N4O3/c1-3-4-9-22-14(20)11-5-7-12(8-6-11)16-13-10(2)18-19-15(21)17-13/h5-8H,2-4,9H2,1H3,(H,16,17,21) |
| InChIKey | HXKNIDMYNLTEKQ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 92.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|