C20H21N3O6 — CID 137270252
4-[[(2S)-8-(dimethylamino)-5-hydroxy-4-oxo-2,3-dihydro-1H-naphthalen-2-yl]methyl]-2,5-dihydroxy-6-imino-3-oxocyclohexa-1,4-diene-1-carboxamide (PubChem CID 137270252) has the molecular formula C20H21N3O6 and a molecular weight of 399.40 g/mol. Its IUPAC name is 4-[[(2S)-8-(dimethylamino)-5-hydroxy-4-oxo-2,3-dihydro-1H-naphthalen-2-yl]methyl]-2,5-dihydroxy-6-imino-3-oxocyclohexa-1,4-diene-1-carboxamide.
| Compound Name | 4-[[(2S)-8-(dimethylamino)-5-hydroxy-4-oxo-2,3-dihydro-1H-naphthalen-2-yl]methyl]-2,5-dihydroxy-6-imino-3-oxocyclohexa-1,4-diene-1-carboxamide |
|---|---|
| PubChem CID | 137270252 |
| Molecular Formula | C20H21N3O6 |
| Molecular Weight | 399.40 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | 4-[[(2S)-8-(dimethylamino)-5-hydroxy-4-oxo-2,3-dihydro-1H-naphthalen-2-yl]methyl]-2,5-dihydroxy-6-imino-3-oxocyclohexa-1,4-diene-1-carboxamide |
| SMILES | [H]/N=C1\C(O)=C(C[C@H]2CC(=O)c3c(O)ccc(N(C)C)c3C2)C(=O)C(O)=C1C(N)=O |
| InChI | InChI=1S/C20H21N3O6/c1-23(2)11-3-4-12(24)14-9(11)5-8(7-13(14)25)6-10-17(26)16(21)15(20(22)29)19(28)18(10)27/h3-4,8,21,24,26,28H,5-7H2,1-2H3,(H2,22,29)/b21-16-/t8-/m0/s1 |
| InChIKey | MXTNTIKZJVMZCX-IDBGXDATSA-N |
| XLogP | 1.31 |
| TPSA | 165.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.40 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|