C21H21N3O8 — CID 59603277
(4Z)-7-(dimethylamino)-3,10,11,12a-tetrahydroxy-4-hydroxyimino-1,12-dioxo-4a,5,5a,6-tetrahydrotetracene-2-carboxamide (PubChem CID 59603277) has the molecular formula C21H21N3O8 and a molecular weight of 443.41 g/mol. Its IUPAC name is (4Z)-7-(dimethylamino)-3,10,11,12a-tetrahydroxy-4-hydroxyimino-1,12-dioxo-4a,5,5a,6-tetrahydrotetracene-2-carboxamide.
| Compound Name | (4Z)-7-(dimethylamino)-3,10,11,12a-tetrahydroxy-4-hydroxyimino-1,12-dioxo-4a,5,5a,6-tetrahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 59603277 |
| Molecular Formula | C21H21N3O8 |
| Molecular Weight | 443.41 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | (4Z)-7-(dimethylamino)-3,10,11,12a-tetrahydroxy-4-hydroxyimino-1,12-dioxo-4a,5,5a,6-tetrahydrotetracene-2-carboxamide |
| SMILES | CN(C)c1ccc(O)c2c1CC1CC3/C(=N/O)C(O)=C(C(N)=O)C(=O)C3(O)C(=O)C1=C2O |
| InChI | InChI=1S/C21H21N3O8/c1-24(2)10-3-4-11(25)13-8(10)5-7-6-9-15(23-32)17(27)14(20(22)30)19(29)21(9,31)18(28)12(7)16(13)26/h3-4,7,9,25-27,31-32H,5-6H2,1-2H3,(H2,22,30)/b23-15- |
| InChIKey | IGWWNKBLSDBMSC-HAHDFKILSA-N |
| XLogP | -0.07 |
| TPSA | 193.98 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.41 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|