C22H22N2O8 — CID 59597473
(4E,12aS)-2-acetyl-7-(dimethylamino)-3,10,11,12a-tetrahydroxy-4-hydroxyimino-4a,5,5a,6-tetrahydrotetracene-1,12-dione (PubChem CID 59597473) has the molecular formula C22H22N2O8 and a molecular weight of 442.42 g/mol. Its IUPAC name is (4E,12aS)-2-acetyl-7-(dimethylamino)-3,10,11,12a-tetrahydroxy-4-hydroxyimino-4a,5,5a,6-tetrahydrotetracene-1,12-dione.
| Compound Name | (4E,12aS)-2-acetyl-7-(dimethylamino)-3,10,11,12a-tetrahydroxy-4-hydroxyimino-4a,5,5a,6-tetrahydrotetracene-1,12-dione |
|---|---|
| PubChem CID | 59597473 |
| Molecular Formula | C22H22N2O8 |
| Molecular Weight | 442.42 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | (4E,12aS)-2-acetyl-7-(dimethylamino)-3,10,11,12a-tetrahydroxy-4-hydroxyimino-4a,5,5a,6-tetrahydrotetracene-1,12-dione |
| SMILES | CC(=O)C1=C(O)/C(=N/O)C2CC3Cc4c(N(C)C)ccc(O)c4C(O)=C3C(=O)[C@]2(O)C1=O |
| InChI | InChI=1S/C22H22N2O8/c1-8(25)14-19(28)17(23-32)11-7-9-6-10-12(24(2)3)4-5-13(26)16(10)18(27)15(9)21(30)22(11,31)20(14)29/h4-5,9,11,26-28,31-32H,6-7H2,1-3H3/b23-17+/t9?,11?,22-/m1/s1 |
| InChIKey | RPAOAQGOXNKJTD-PNIKXVJRSA-N |
| XLogP | 1.03 |
| TPSA | 167.96 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.42 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|