C21H20N2O8 — CID 54738040
(3S,7R,8S,10R)-13-(dimethylamino)-3,6,7,16-tetrahydroxy-2,4,18-trioxopentacyclo[8.8.0.01,7.03,8.012,17]octadeca-5,12,14,16-tetraene-5-carboxamide (PubChem CID 54738040) has the molecular formula C21H20N2O8 and a molecular weight of 428.40 g/mol. Its IUPAC name is (3S,7R,8S,10R)-13-(dimethylamino)-3,6,7,16-tetrahydroxy-2,4,18-trioxopentacyclo[8.8.0.01,7.03,8.012,17]octadeca-5,12,14,16-tetraene-5-carboxamide.
| Compound Name | (3S,7R,8S,10R)-13-(dimethylamino)-3,6,7,16-tetrahydroxy-2,4,18-trioxopentacyclo[8.8.0.01,7.03,8.012,17]octadeca-5,12,14,16-tetraene-5-carboxamide |
|---|---|
| PubChem CID | 54738040 |
| Molecular Formula | C21H20N2O8 |
| Molecular Weight | 428.40 g/mol |
| Exact Mass | 428.12 |
| IUPAC Name | (3S,7R,8S,10R)-13-(dimethylamino)-3,6,7,16-tetrahydroxy-2,4,18-trioxopentacyclo[8.8.0.01,7.03,8.012,17]octadeca-5,12,14,16-tetraene-5-carboxamide |
| SMILES | CN(C)c1ccc(O)c2c1CC1C[C@@H]3[C@@]4(O)C(=O)C(C(N)=O)=C(O)[C@]3(O)C1(C2=O)C4=O |
| InChI | InChI=1S/C21H20N2O8/c1-23(2)9-3-4-10(24)12-8(9)5-7-6-11-20(30)15(26)13(17(22)28)16(27)21(11,31)19(7,14(12)25)18(20)29/h3-4,7,11,24,27,30-31H,5-6H2,1-2H3,(H2,22,28)/t7?,11-,19?,20-,21+/m1/s1 |
| InChIKey | HEAAYLJSVXCJRE-LJSFCDGMSA-N |
| XLogP | -1.26 |
| TPSA | 178.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.40 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|