C20H28GeN6O — CID 137272818
1,5-dimethyl-2-phenyl-4-[(5-triethylgermyl-2H-triazol-4-yl)methylideneamino]pyrazol-3-one (PubChem CID 137272818) has the molecular formula C20H28GeN6O and a molecular weight of 441.10 g/mol. Its IUPAC name is 1,5-dimethyl-2-phenyl-4-[(5-triethylgermyl-2H-triazol-4-yl)methylideneamino]pyrazol-3-one.
| Compound Name | 1,5-dimethyl-2-phenyl-4-[(5-triethylgermyl-2H-triazol-4-yl)methylideneamino]pyrazol-3-one |
|---|---|
| PubChem CID | 137272818 |
| Molecular Formula | C20H28GeN6O |
| Molecular Weight | 441.10 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | 1,5-dimethyl-2-phenyl-4-[(5-triethylgermyl-2H-triazol-4-yl)methylideneamino]pyrazol-3-one |
| SMILES | CC[Ge](CC)(CC)c1n[nH]nc1/C=N/c1c(C)n(C)n(-c2ccccc2)c1=O |
| InChI | InChI=1S/C20H28GeN6O/c1-6-21(7-2,8-3)19-17(23-25-24-19)14-22-18-15(4)26(5)27(20(18)28)16-12-10-9-11-13-16/h9-14H,6-8H2,1-5H3,(H,23,24,25)/b22-14+ |
| InChIKey | YFSKKBMQNLLJQC-HYARGMPZSA-N |
| XLogP | 3.07 |
| TPSA | 80.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.10 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|