C20H26N4OS — CID 137273877
(4E)-4-(3H-1,3-benzothiazol-2-ylidene)-5-imino-1-(2,2,6,6-tetramethylpiperidin-4-yl)pyrrolidin-2-one (PubChem CID 137273877) has the molecular formula C20H26N4OS and a molecular weight of 370.52 g/mol. Its IUPAC name is (4E)-4-(3H-1,3-benzothiazol-2-ylidene)-5-imino-1-(2,2,6,6-tetramethylpiperidin-4-yl)pyrrolidin-2-one.
| Compound Name | (4E)-4-(3H-1,3-benzothiazol-2-ylidene)-5-imino-1-(2,2,6,6-tetramethylpiperidin-4-yl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 137273877 |
| Molecular Formula | C20H26N4OS |
| Molecular Weight | 370.52 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | (4E)-4-(3H-1,3-benzothiazol-2-ylidene)-5-imino-1-(2,2,6,6-tetramethylpiperidin-4-yl)pyrrolidin-2-one |
| SMILES | [H]/N=C1C(=C2\Nc3ccccc3S2)/CC(=O)N/1C1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C20H26N4OS/c1-19(2)10-12(11-20(3,4)23-19)24-16(25)9-13(17(24)21)18-22-14-7-5-6-8-15(14)26-18/h5-8,12,21-23H,9-11H2,1-4H3/b18-13+,21-17- |
| InChIKey | QNCYLEJVGQFEGB-KQPZIIFQSA-N |
| XLogP | 3.93 |
| TPSA | 68.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.52 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|