C17H13N3OS — CID 135543863
(4E)-4-(3H-1,3-benzothiazol-2-ylidene)-5-imino-1-phenylpyrrolidin-2-one (PubChem CID 135543863) has the molecular formula C17H13N3OS and a molecular weight of 307.38 g/mol. Its IUPAC name is (4E)-4-(3H-1,3-benzothiazol-2-ylidene)-5-imino-1-phenylpyrrolidin-2-one.
| Compound Name | (4E)-4-(3H-1,3-benzothiazol-2-ylidene)-5-imino-1-phenylpyrrolidin-2-one |
|---|---|
| PubChem CID | 135543863 |
| Molecular Formula | C17H13N3OS |
| Molecular Weight | 307.38 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | (4E)-4-(3H-1,3-benzothiazol-2-ylidene)-5-imino-1-phenylpyrrolidin-2-one |
| SMILES | [H]/N=C1C(=C2\Nc3ccccc3S2)/CC(=O)N/1c1ccccc1 |
| InChI | InChI=1S/C17H13N3OS/c18-16-12(17-19-13-8-4-5-9-14(13)22-17)10-15(21)20(16)11-6-2-1-3-7-11/h1-9,18-19H,10H2/b17-12+,18-16- |
| InChIKey | PVRYMAVPSZZOHU-XCXBMYBGSA-N |
| XLogP | 3.83 |
| TPSA | 56.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.38 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|