C24H19N3OS — CID 135777305
(3R,4Z)-4-(3H-1,3-benzothiazol-2-ylidene)-5-imino-1-(4-methylphenyl)-3-phenylpyrrolidin-2-one (PubChem CID 135777305) has the molecular formula C24H19N3OS and a molecular weight of 397.50 g/mol. Its IUPAC name is (3R,4Z)-4-(3H-1,3-benzothiazol-2-ylidene)-5-imino-1-(4-methylphenyl)-3-phenylpyrrolidin-2-one.
| Compound Name | (3R,4Z)-4-(3H-1,3-benzothiazol-2-ylidene)-5-imino-1-(4-methylphenyl)-3-phenylpyrrolidin-2-one |
|---|---|
| PubChem CID | 135777305 |
| Molecular Formula | C24H19N3OS |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | (3R,4Z)-4-(3H-1,3-benzothiazol-2-ylidene)-5-imino-1-(4-methylphenyl)-3-phenylpyrrolidin-2-one |
| SMILES | [H]/N=C1C(=C2/Nc3ccccc3S2)/[C@@H](c2ccccc2)C(=O)N/1c1ccc(C)cc1 |
| InChI | InChI=1S/C24H19N3OS/c1-15-11-13-17(14-12-15)27-22(25)21(20(24(27)28)16-7-3-2-4-8-16)23-26-18-9-5-6-10-19(18)29-23/h2-14,20,25-26H,1H3/b23-21-,25-22-/t20-/m1/s1 |
| InChIKey | XYZKVRQLSSQKHF-HCUNFHGBSA-N |
| XLogP | 5.53 |
| TPSA | 56.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|