C16H19N5O3 — CID 137275682
(5Z)-5-[(E)-(2-butoxy-3-methoxyphenyl)methylidenehydrazinylidene]-6-methylidene-1,2,4-triazin-3-one (PubChem CID 137275682) has the molecular formula C16H19N5O3 and a molecular weight of 329.36 g/mol. Its IUPAC name is (5Z)-5-[(E)-(2-butoxy-3-methoxyphenyl)methylidenehydrazinylidene]-6-methylidene-1,2,4-triazin-3-one.
| Compound Name | (5Z)-5-[(E)-(2-butoxy-3-methoxyphenyl)methylidenehydrazinylidene]-6-methylidene-1,2,4-triazin-3-one |
|---|---|
| PubChem CID | 137275682 |
| Molecular Formula | C16H19N5O3 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.15 |
| IUPAC Name | (5Z)-5-[(E)-(2-butoxy-3-methoxyphenyl)methylidenehydrazinylidene]-6-methylidene-1,2,4-triazin-3-one |
| SMILES | C=C1N=NC(=O)N/C1=N\N=C\c1cccc(OC)c1OCCCC |
| InChI | InChI=1S/C16H19N5O3/c1-4-5-9-24-14-12(7-6-8-13(14)23-3)10-17-20-15-11(2)19-21-16(22)18-15/h6-8,10H,2,4-5,9H2,1,3H3,(H,18,20,22)/b17-10+ |
| InChIKey | HJUYDLWZBFQJBJ-LICLKQGHSA-N |
| XLogP | 3.30 |
| TPSA | 97.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|