C17H21N5O3 — CID 137262582
(5Z)-5-[(E)-(3-methoxy-2-pentoxyphenyl)methylidenehydrazinylidene]-6-methylidene-1,2,4-triazin-3-one (PubChem CID 137262582) has the molecular formula C17H21N5O3 and a molecular weight of 343.39 g/mol. Its IUPAC name is (5Z)-5-[(E)-(3-methoxy-2-pentoxyphenyl)methylidenehydrazinylidene]-6-methylidene-1,2,4-triazin-3-one.
| Compound Name | (5Z)-5-[(E)-(3-methoxy-2-pentoxyphenyl)methylidenehydrazinylidene]-6-methylidene-1,2,4-triazin-3-one |
|---|---|
| PubChem CID | 137262582 |
| Molecular Formula | C17H21N5O3 |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | (5Z)-5-[(E)-(3-methoxy-2-pentoxyphenyl)methylidenehydrazinylidene]-6-methylidene-1,2,4-triazin-3-one |
| SMILES | C=C1N=NC(=O)N/C1=N\N=C\c1cccc(OC)c1OCCCCC |
| InChI | InChI=1S/C17H21N5O3/c1-4-5-6-10-25-15-13(8-7-9-14(15)24-3)11-18-21-16-12(2)20-22-17(23)19-16/h7-9,11H,2,4-6,10H2,1,3H3,(H,19,21,23)/b18-11+ |
| InChIKey | MAWUKDJTHKMISU-WOJGMQOQSA-N |
| XLogP | 3.69 |
| TPSA | 97.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|