C19H17N5O3 — CID 137275675
(5E)-5-[(E)-(3-methoxy-2-phenylmethoxyphenyl)methylidenehydrazinylidene]-6-methylidene-1,2,4-triazin-3-one (PubChem CID 137275675) has the molecular formula C19H17N5O3 and a molecular weight of 363.38 g/mol. Its IUPAC name is (5E)-5-[(E)-(3-methoxy-2-phenylmethoxyphenyl)methylidenehydrazinylidene]-6-methylidene-1,2,4-triazin-3-one.
| Compound Name | (5E)-5-[(E)-(3-methoxy-2-phenylmethoxyphenyl)methylidenehydrazinylidene]-6-methylidene-1,2,4-triazin-3-one |
|---|---|
| PubChem CID | 137275675 |
| Molecular Formula | C19H17N5O3 |
| Molecular Weight | 363.38 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | (5E)-5-[(E)-(3-methoxy-2-phenylmethoxyphenyl)methylidenehydrazinylidene]-6-methylidene-1,2,4-triazin-3-one |
| SMILES | C=C1N=NC(=O)N/C1=N/N=C/c1cccc(OC)c1OCc1ccccc1 |
| InChI | InChI=1S/C19H17N5O3/c1-13-18(21-19(25)24-22-13)23-20-11-15-9-6-10-16(26-2)17(15)27-12-14-7-4-3-5-8-14/h3-11H,1,12H2,2H3,(H,21,23,25)/b20-11+ |
| InChIKey | KLOOIWIZWSPMCX-RGVLZGJSSA-N |
| XLogP | 3.70 |
| TPSA | 97.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.38 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|