C17H23N3O3 — CID 137278660
ethyl (9R)-6,6,9-trimethyl-1-oxo-7,8,9,10-tetrahydro-5H-pyrimido[1,2-a]quinazoline-2-carboxylate (PubChem CID 137278660) has the molecular formula C17H23N3O3 and a molecular weight of 317.39 g/mol. Its IUPAC name is ethyl (9R)-6,6,9-trimethyl-1-oxo-7,8,9,10-tetrahydro-5H-pyrimido[1,2-a]quinazoline-2-carboxylate.
| Compound Name | ethyl (9R)-6,6,9-trimethyl-1-oxo-7,8,9,10-tetrahydro-5H-pyrimido[1,2-a]quinazoline-2-carboxylate |
|---|---|
| PubChem CID | 137278660 |
| Molecular Formula | C17H23N3O3 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | ethyl (9R)-6,6,9-trimethyl-1-oxo-7,8,9,10-tetrahydro-5H-pyrimido[1,2-a]quinazoline-2-carboxylate |
| SMILES | CCOC(=O)c1cnc2n(c1=O)C1=C(CC[C@@H](C)C1)C(C)(C)N2 |
| InChI | InChI=1S/C17H23N3O3/c1-5-23-15(22)11-9-18-16-19-17(3,4)12-7-6-10(2)8-13(12)20(16)14(11)21/h9-10H,5-8H2,1-4H3,(H,18,19)/t10-/m1/s1 |
| InChIKey | QGIGMSUTTGKKTG-SNVBAGLBSA-N |
| XLogP | 2.66 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |