C26H18N4O — CID 137278722
2-benzyl-3-hydroxy-6,8-diphenylimidazo[1,2-a]pyrazine-5-carbonitrile (PubChem CID 137278722) has the molecular formula C26H18N4O and a molecular weight of 402.46 g/mol. Its IUPAC name is 2-benzyl-3-hydroxy-6,8-diphenylimidazo[1,2-a]pyrazine-5-carbonitrile.
| Compound Name | 2-benzyl-3-hydroxy-6,8-diphenylimidazo[1,2-a]pyrazine-5-carbonitrile |
|---|---|
| PubChem CID | 137278722 |
| Molecular Formula | C26H18N4O |
| Molecular Weight | 402.46 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | 2-benzyl-3-hydroxy-6,8-diphenylimidazo[1,2-a]pyrazine-5-carbonitrile |
| SMILES | N#Cc1c(-c2ccccc2)nc(-c2ccccc2)c2nc(Cc3ccccc3)c(O)n12 |
| InChI | InChI=1S/C26H18N4O/c27-17-22-23(19-12-6-2-7-13-19)29-24(20-14-8-3-9-15-20)25-28-21(26(31)30(22)25)16-18-10-4-1-5-11-18/h1-15,31H,16H2 |
| InChIKey | XMTNFSDBOPZWOF-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 74.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.46 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |