C21H24FN10O9P2+ — CID 137282474
2-amino-9-[8-(6-aminopurin-9-yl)-9-fluoro-18-methoxy-12-oxo-2,4,7,11,13,16-hexaoxa-3-phospha-12-phosphoniatricyclo[13.2.1.06,10]octadecan-17-yl]-1H-purin-6-one (PubChem CID 137282474) has the molecular formula C21H24FN10O9P2+ and a molecular weight of 641.43 g/mol. Its IUPAC name is 2-amino-9-[8-(6-aminopurin-9-yl)-9-fluoro-18-methoxy-12-oxo-2,4,7,11,13,16-hexaoxa-3-phospha-12-phosphoniatricyclo[13.2.1.06,10]octadecan-17-yl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[8-(6-aminopurin-9-yl)-9-fluoro-18-methoxy-12-oxo-2,4,7,11,13,16-hexaoxa-3-phospha-12-phosphoniatricyclo[13.2.1.06,10]octadecan-17-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 137282474 |
| Molecular Formula | C21H24FN10O9P2+ |
| Molecular Weight | 641.43 g/mol |
| Exact Mass | 641.12 |
| IUPAC Name | 2-amino-9-[8-(6-aminopurin-9-yl)-9-fluoro-18-methoxy-12-oxo-2,4,7,11,13,16-hexaoxa-3-phospha-12-phosphoniatricyclo[13.2.1.06,10]octadecan-17-yl]-1H-purin-6-one |
| SMILES | COC1C2CO[P+](=O)OC3C(COPOC1C(n1cnc4c(=O)[nH]c(N)nc41)O2)OC(n1cnc2c(N)ncnc21)C3F |
| InChI | InChI=1S/C21H23FN10O9P2/c1-35-13-8-3-37-43(34)41-12-7(38-19(9(12)22)31-5-27-10-15(23)25-4-26-16(10)31)2-36-42-40-14(13)20(39-8)32-6-28-11-17(32)29-21(24)30-18(11)33/h4-9,12-14,19-20,42H,2-3H2,1H3,(H4-,23,24,25,26,29,30,33)/p+1 |
| InChIKey | VFTKKUXLEMWALY-UHFFFAOYSA-O |
| XLogP | 0.25 |
| TPSA | 240.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.43 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|