C17H18N6OS — CID 137284946
4-[(E)-(2-hydroxynaphthalen-1-yl)methylideneamino]-3-(5-methylpyrazolidin-3-yl)-1H-1,2,4-triazole-5-thione (PubChem CID 137284946) has the molecular formula C17H18N6OS and a molecular weight of 354.44 g/mol. Its IUPAC name is 4-[(E)-(2-hydroxynaphthalen-1-yl)methylideneamino]-3-(5-methylpyrazolidin-3-yl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[(E)-(2-hydroxynaphthalen-1-yl)methylideneamino]-3-(5-methylpyrazolidin-3-yl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 137284946 |
| Molecular Formula | C17H18N6OS |
| Molecular Weight | 354.44 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | 4-[(E)-(2-hydroxynaphthalen-1-yl)methylideneamino]-3-(5-methylpyrazolidin-3-yl)-1H-1,2,4-triazole-5-thione |
| SMILES | CC1CC(c2n[nH]c(=S)n2/N=C/c2c(O)ccc3ccccc23)NN1 |
| InChI | InChI=1S/C17H18N6OS/c1-10-8-14(20-19-10)16-21-22-17(25)23(16)18-9-13-12-5-3-2-4-11(12)6-7-15(13)24/h2-7,9-10,14,19-20,24H,8H2,1H3,(H,22,25)/b18-9+ |
| InChIKey | ALNGLUWTKIBTOT-GIJQJNRQSA-N |
| XLogP | 2.61 |
| TPSA | 90.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.44 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|