C23H13F8N3O — CID 137287269
4-[2-cyclopropyl-6-[4-fluoro-3-(1,1,2,2,2-pentafluoroethyl)phenyl]imidazo[1,2-a]pyrazin-3-yl]-3,5-difluorophenol (PubChem CID 137287269) has the molecular formula C23H13F8N3O and a molecular weight of 499.36 g/mol. Its IUPAC name is 4-[2-cyclopropyl-6-[4-fluoro-3-(1,1,2,2,2-pentafluoroethyl)phenyl]imidazo[1,2-a]pyrazin-3-yl]-3,5-difluorophenol.
| Compound Name | 4-[2-cyclopropyl-6-[4-fluoro-3-(1,1,2,2,2-pentafluoroethyl)phenyl]imidazo[1,2-a]pyrazin-3-yl]-3,5-difluorophenol |
|---|---|
| PubChem CID | 137287269 |
| Molecular Formula | C23H13F8N3O |
| Molecular Weight | 499.36 g/mol |
| Exact Mass | 499.09 |
| IUPAC Name | 4-[2-cyclopropyl-6-[4-fluoro-3-(1,1,2,2,2-pentafluoroethyl)phenyl]imidazo[1,2-a]pyrazin-3-yl]-3,5-difluorophenol |
| SMILES | Oc1cc(F)c(-c2c(C3CC3)nc3cnc(-c4ccc(F)c(C(F)(F)C(F)(F)F)c4)cn23)c(F)c1 |
| InChI | InChI=1S/C23H13F8N3O/c24-14-4-3-11(5-13(14)22(27,28)23(29,30)31)17-9-34-18(8-32-17)33-20(10-1-2-10)21(34)19-15(25)6-12(35)7-16(19)26/h3-10,35H,1-2H2 |
| InChIKey | XKQVJLQRRDECRH-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 50.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.36 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|