C12H13N8O5+ — CID 137288191
8-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)diazenyl]-1,3,7-trimethyl-5H-purin-7-ium-2,6-dione (PubChem CID 137288191) has the molecular formula C12H13N8O5+ and a molecular weight of 349.29 g/mol. Its IUPAC name is 8-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)diazenyl]-1,3,7-trimethyl-5H-purin-7-ium-2,6-dione.
| Compound Name | 8-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)diazenyl]-1,3,7-trimethyl-5H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 137288191 |
| Molecular Formula | C12H13N8O5+ |
| Molecular Weight | 349.29 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | 8-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)diazenyl]-1,3,7-trimethyl-5H-purin-7-ium-2,6-dione |
| SMILES | CN1C(=O)C2C(=NC(/N=N/c3c(O)[nH]c(=O)[nH]c3=O)=[N+]2C)N(C)C1=O |
| InChI | InChI=1S/C12H12N8O5/c1-18-5-6(19(2)12(25)20(3)9(5)23)13-10(18)17-16-4-7(21)14-11(24)15-8(4)22/h5H,1-3H3,(H2,14,15,21,22,24)/p+1 |
| InChIKey | VNHYCZLMMGPGEJ-UHFFFAOYSA-O |
| XLogP | -1.84 |
| TPSA | 166.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.29 |
| LogP ≤ 5 | -1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|