C14H15N8O5+ — CID 156593277
8-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)diazenyl]-3,7-dimethyl-1-prop-2-enyl-5H-purin-7-ium-2,6-dione (PubChem CID 156593277) has the molecular formula C14H15N8O5+ and a molecular weight of 375.33 g/mol. Its IUPAC name is 8-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)diazenyl]-3,7-dimethyl-1-prop-2-enyl-5H-purin-7-ium-2,6-dione.
| Compound Name | 8-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)diazenyl]-3,7-dimethyl-1-prop-2-enyl-5H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 156593277 |
| Molecular Formula | C14H15N8O5+ |
| Molecular Weight | 375.33 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | 8-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)diazenyl]-3,7-dimethyl-1-prop-2-enyl-5H-purin-7-ium-2,6-dione |
| SMILES | C=CCN1C(=O)C2C(=NC(/N=N/c3c(O)[nH]c(=O)[nH]c3=O)=[N+]2C)N(C)C1=O |
| InChI | InChI=1S/C14H14N8O5/c1-4-5-22-11(25)7-8(21(3)14(22)27)15-12(20(7)2)19-18-6-9(23)16-13(26)17-10(6)24/h4,7H,1,5H2,2-3H3,(H2,16,17,23,24,26)/p+1 |
| InChIKey | LNIQFUBFRZHERG-UHFFFAOYSA-O |
| XLogP | -1.29 |
| TPSA | 166.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.33 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|