C23H24N2O7 — CID 137288274
[(6S,8aR)-6-methoxy-2-phenyl-8-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] 2-diazoacetate (PubChem CID 137288274) has the molecular formula C23H24N2O7 and a molecular weight of 440.45 g/mol. Its IUPAC name is [(6S,8aR)-6-methoxy-2-phenyl-8-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] 2-diazoacetate.
| Compound Name | [(6S,8aR)-6-methoxy-2-phenyl-8-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] 2-diazoacetate |
|---|---|
| PubChem CID | 137288274 |
| Molecular Formula | C23H24N2O7 |
| Molecular Weight | 440.45 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | [(6S,8aR)-6-methoxy-2-phenyl-8-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] 2-diazoacetate |
| SMILES | CO[C@H]1OC2COC(c3ccccc3)O[C@H]2C(OCc2ccccc2)C1OC(=O)C=[N+]=[N-] |
| InChI | InChI=1S/C23H24N2O7/c1-27-23-21(31-18(26)12-25-24)20(28-13-15-8-4-2-5-9-15)19-17(30-23)14-29-22(32-19)16-10-6-3-7-11-16/h2-12,17,19-23H,13-14H2,1H3/t17?,19-,20?,21?,22?,23+/m1/s1 |
| InChIKey | MBDDWMQWLFBGBF-XMSIFOTPSA-N |
| XLogP | 2.27 |
| TPSA | 108.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.45 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|