C17H19ClFN5O — CID 137291466
5-chloro-4-(2,6-diazaspiro[4.5]decan-2-yl)-2-(2-fluoro-4-pyridinyl)-1H-pyrimidin-6-one (PubChem CID 137291466) has the molecular formula C17H19ClFN5O and a molecular weight of 363.82 g/mol. Its IUPAC name is 5-chloro-4-(2,6-diazaspiro[4.5]decan-2-yl)-2-(2-fluoro-4-pyridinyl)-1H-pyrimidin-6-one.
| Compound Name | 5-chloro-4-(2,6-diazaspiro[4.5]decan-2-yl)-2-(2-fluoro-4-pyridinyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 137291466 |
| Molecular Formula | C17H19ClFN5O |
| Molecular Weight | 363.82 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | 5-chloro-4-(2,6-diazaspiro[4.5]decan-2-yl)-2-(2-fluoro-4-pyridinyl)-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]c(-c2ccnc(F)c2)nc(N2CCC3(CCCCN3)C2)c1Cl |
| InChI | InChI=1S/C17H19ClFN5O/c18-13-15(24-8-5-17(10-24)4-1-2-6-21-17)22-14(23-16(13)25)11-3-7-20-12(19)9-11/h3,7,9,21H,1-2,4-6,8,10H2,(H,22,23,25) |
| InChIKey | HFMTYRPXINWZND-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.82 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|