C13H17NO6 — CID 137295393
ethyl 2-[(2,5-dihydroxy-3,4-dimethoxyphenyl)methylideneamino]acetate (PubChem CID 137295393) has the molecular formula C13H17NO6 and a molecular weight of 283.28 g/mol. Its IUPAC name is ethyl 2-[(2,5-dihydroxy-3,4-dimethoxyphenyl)methylideneamino]acetate.
| Compound Name | ethyl 2-[(2,5-dihydroxy-3,4-dimethoxyphenyl)methylideneamino]acetate |
|---|---|
| PubChem CID | 137295393 |
| Molecular Formula | C13H17NO6 |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | ethyl 2-[(2,5-dihydroxy-3,4-dimethoxyphenyl)methylideneamino]acetate |
| SMILES | CCOC(=O)C/N=C/c1cc(O)c(OC)c(OC)c1O |
| InChI | InChI=1S/C13H17NO6/c1-4-20-10(16)7-14-6-8-5-9(15)12(18-2)13(19-3)11(8)17/h5-6,15,17H,4,7H2,1-3H3/b14-6+ |
| InChIKey | HOWKEXVORJSZBJ-MKMNVTDBSA-N |
| XLogP | 1.10 |
| TPSA | 97.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|