C16H23N5O2S2 — CID 137296557
3-(4-methyl-2-methylsulfanyl-6-oxo-1H-pyrimidin-5-yl)-N-(5-pentyl-1,3,4-thiadiazol-2-yl)propanamide (PubChem CID 137296557) has the molecular formula C16H23N5O2S2 and a molecular weight of 381.53 g/mol. Its IUPAC name is 3-(4-methyl-2-methylsulfanyl-6-oxo-1H-pyrimidin-5-yl)-N-(5-pentyl-1,3,4-thiadiazol-2-yl)propanamide.
| Compound Name | 3-(4-methyl-2-methylsulfanyl-6-oxo-1H-pyrimidin-5-yl)-N-(5-pentyl-1,3,4-thiadiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 137296557 |
| Molecular Formula | C16H23N5O2S2 |
| Molecular Weight | 381.53 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | 3-(4-methyl-2-methylsulfanyl-6-oxo-1H-pyrimidin-5-yl)-N-(5-pentyl-1,3,4-thiadiazol-2-yl)propanamide |
| SMILES | CCCCCc1nnc(NC(=O)CCc2c(C)nc(SC)[nH]c2=O)s1 |
| InChI | InChI=1S/C16H23N5O2S2/c1-4-5-6-7-13-20-21-16(25-13)18-12(22)9-8-11-10(2)17-15(24-3)19-14(11)23/h4-9H2,1-3H3,(H,17,19,23)(H,18,21,22) |
| InChIKey | SGJLYDJUYVJGQO-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.53 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|