C18H28N4O2S2 — CID 43052396
2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]-N-(5-octyl-1,3,4-thiadiazol-2-yl)acetamide (PubChem CID 43052396) has the molecular formula C18H28N4O2S2 and a molecular weight of 396.58 g/mol. Its IUPAC name is 2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]-N-(5-octyl-1,3,4-thiadiazol-2-yl)acetamide.
| Compound Name | 2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]-N-(5-octyl-1,3,4-thiadiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 43052396 |
| Molecular Formula | C18H28N4O2S2 |
| Molecular Weight | 396.58 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | 2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]-N-(5-octyl-1,3,4-thiadiazol-2-yl)acetamide |
| SMILES | CCCCCCCCc1nnc(NC(=O)CSCc2c(C)noc2C)s1 |
| InChI | InChI=1S/C18H28N4O2S2/c1-4-5-6-7-8-9-10-17-20-21-18(26-17)19-16(23)12-25-11-15-13(2)22-24-14(15)3/h4-12H2,1-3H3,(H,19,21,23) |
| InChIKey | ABUWOMABJBOJLX-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 80.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.58 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|