C16H25N5O2S2 — CID 55792983
2-[(5-methyl-1,2,4-oxadiazol-3-yl)methylsulfanyl]-N-(5-octyl-1,3,4-thiadiazol-2-yl)acetamide (PubChem CID 55792983) has the molecular formula C16H25N5O2S2 and a molecular weight of 383.54 g/mol. Its IUPAC name is 2-[(5-methyl-1,2,4-oxadiazol-3-yl)methylsulfanyl]-N-(5-octyl-1,3,4-thiadiazol-2-yl)acetamide.
| Compound Name | 2-[(5-methyl-1,2,4-oxadiazol-3-yl)methylsulfanyl]-N-(5-octyl-1,3,4-thiadiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 55792983 |
| Molecular Formula | C16H25N5O2S2 |
| Molecular Weight | 383.54 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | 2-[(5-methyl-1,2,4-oxadiazol-3-yl)methylsulfanyl]-N-(5-octyl-1,3,4-thiadiazol-2-yl)acetamide |
| SMILES | CCCCCCCCc1nnc(NC(=O)CSCc2noc(C)n2)s1 |
| InChI | InChI=1S/C16H25N5O2S2/c1-3-4-5-6-7-8-9-15-19-20-16(25-15)18-14(22)11-24-10-13-17-12(2)23-21-13/h3-11H2,1-2H3,(H,18,20,22) |
| InChIKey | HMYNWTFYBZBODK-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 93.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.54 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|