C23H29N5O2 — CID 137299384
5-[1-[[4-(dimethylamino)phenyl]methyl]piperidin-4-yl]-2-(4-methoxyphenyl)-4H-1,2,4-triazol-3-one (PubChem CID 137299384) has the molecular formula C23H29N5O2 and a molecular weight of 407.52 g/mol. Its IUPAC name is 5-[1-[[4-(dimethylamino)phenyl]methyl]piperidin-4-yl]-2-(4-methoxyphenyl)-4H-1,2,4-triazol-3-one.
| Compound Name | 5-[1-[[4-(dimethylamino)phenyl]methyl]piperidin-4-yl]-2-(4-methoxyphenyl)-4H-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 137299384 |
| Molecular Formula | C23H29N5O2 |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.23 |
| IUPAC Name | 5-[1-[[4-(dimethylamino)phenyl]methyl]piperidin-4-yl]-2-(4-methoxyphenyl)-4H-1,2,4-triazol-3-one |
| SMILES | COc1ccc(-n2nc(C3CCN(Cc4ccc(N(C)C)cc4)CC3)[nH]c2=O)cc1 |
| InChI | InChI=1S/C23H29N5O2/c1-26(2)19-6-4-17(5-7-19)16-27-14-12-18(13-15-27)22-24-23(29)28(25-22)20-8-10-21(30-3)11-9-20/h4-11,18H,12-16H2,1-3H3,(H,24,25,29) |
| InChIKey | OQGCIEIVGVXTHH-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 66.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|