C10H8Br2ClNO2 — CID 137303928
4-chloro-2-[(E)-[(E)-2,3-dibromoprop-2-enoxy]iminomethyl]phenol (PubChem CID 137303928) has the molecular formula C10H8Br2ClNO2 and a molecular weight of 369.44 g/mol. Its IUPAC name is 4-chloro-2-[(E)-[(E)-2,3-dibromoprop-2-enoxy]iminomethyl]phenol.
| Compound Name | 4-chloro-2-[(E)-[(E)-2,3-dibromoprop-2-enoxy]iminomethyl]phenol |
|---|---|
| PubChem CID | 137303928 |
| Molecular Formula | C10H8Br2ClNO2 |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 366.86 |
| IUPAC Name | 4-chloro-2-[(E)-[(E)-2,3-dibromoprop-2-enoxy]iminomethyl]phenol |
| SMILES | Oc1ccc(Cl)cc1/C=N/OC/C(Br)=C\Br |
| InChI | InChI=1S/C10H8Br2ClNO2/c11-4-8(12)6-16-14-5-7-3-9(13)1-2-10(7)15/h1-5,15H,6H2/b8-4+,14-5+ |
| InChIKey | NUIKSBLFDKHYMQ-IWGDNDHUSA-N |
| XLogP | 4.03 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|