C17H15F2N3O — CID 137304248
2-[2-amino-1-(3-fluorophenyl)ethyl]-8-fluoro-5-methyl-3H-quinazolin-4-one (PubChem CID 137304248) has the molecular formula C17H15F2N3O and a molecular weight of 315.32 g/mol. Its IUPAC name is 2-[2-amino-1-(3-fluorophenyl)ethyl]-8-fluoro-5-methyl-3H-quinazolin-4-one.
| Compound Name | 2-[2-amino-1-(3-fluorophenyl)ethyl]-8-fluoro-5-methyl-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 137304248 |
| Molecular Formula | C17H15F2N3O |
| Molecular Weight | 315.32 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | 2-[2-amino-1-(3-fluorophenyl)ethyl]-8-fluoro-5-methyl-3H-quinazolin-4-one |
| SMILES | Cc1ccc(F)c2nc(C(CN)c3cccc(F)c3)[nH]c(=O)c12 |
| InChI | InChI=1S/C17H15F2N3O/c1-9-5-6-13(19)15-14(9)17(23)22-16(21-15)12(8-20)10-3-2-4-11(18)7-10/h2-7,12H,8,20H2,1H3,(H,21,22,23) |
| InChIKey | PULTZMBPZLRXND-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.32 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |