C40H24N10S — CID 137305760
1-[3-[8-(8-pyrido[3,2-b]indol-5-ylpyrido[3,2-b]indol-5-yl)pyrido[3,2-b]indol-5-yl]phenyl]tetrazole-5-thiol (PubChem CID 137305760) has the molecular formula C40H24N10S and a molecular weight of 676.77 g/mol. Its IUPAC name is 1-[3-[8-(8-pyrido[3,2-b]indol-5-ylpyrido[3,2-b]indol-5-yl)pyrido[3,2-b]indol-5-yl]phenyl]tetrazole-5-thiol.
| Compound Name | 1-[3-[8-(8-pyrido[3,2-b]indol-5-ylpyrido[3,2-b]indol-5-yl)pyrido[3,2-b]indol-5-yl]phenyl]tetrazole-5-thiol |
|---|---|
| PubChem CID | 137305760 |
| Molecular Formula | C40H24N10S |
| Molecular Weight | 676.77 g/mol |
| Exact Mass | 676.19 |
| IUPAC Name | 1-[3-[8-(8-pyrido[3,2-b]indol-5-ylpyrido[3,2-b]indol-5-yl)pyrido[3,2-b]indol-5-yl]phenyl]tetrazole-5-thiol |
| SMILES | Sc1nnnn1-c1cccc(-n2c3ccc(-n4c5ccc(-n6c7ccccc7c7ncccc76)cc5c5ncccc54)cc3c3ncccc32)c1 |
| InChI | InChI=1S/C40H24N10S/c51-40-44-45-46-50(40)27-8-3-7-24(21-27)47-32-16-15-26(23-29(32)38-35(47)12-5-19-42-38)49-33-17-14-25(22-30(33)39-36(49)13-6-20-43-39)48-31-10-2-1-9-28(31)37-34(48)11-4-18-41-37/h1-23H,(H,44,46,51) |
| InChIKey | HYTAOENTCUZJJD-UHFFFAOYSA-N |
| XLogP | 8.43 |
| TPSA | 97.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.77 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|