C15H15ClN4O4S — CID 137309139
N-(4-chloro-3-nitrophenyl)-3-(4-methyl-2-methylsulfanyl-6-oxo-1H-pyrimidin-5-yl)propanamide (PubChem CID 137309139) has the molecular formula C15H15ClN4O4S and a molecular weight of 382.83 g/mol. Its IUPAC name is N-(4-chloro-3-nitrophenyl)-3-(4-methyl-2-methylsulfanyl-6-oxo-1H-pyrimidin-5-yl)propanamide.
| Compound Name | N-(4-chloro-3-nitrophenyl)-3-(4-methyl-2-methylsulfanyl-6-oxo-1H-pyrimidin-5-yl)propanamide |
|---|---|
| PubChem CID | 137309139 |
| Molecular Formula | C15H15ClN4O4S |
| Molecular Weight | 382.83 g/mol |
| Exact Mass | 382.05 |
| IUPAC Name | N-(4-chloro-3-nitrophenyl)-3-(4-methyl-2-methylsulfanyl-6-oxo-1H-pyrimidin-5-yl)propanamide |
| SMILES | CSc1nc(C)c(CCC(=O)Nc2ccc(Cl)c([N+](=O)[O-])c2)c(=O)[nH]1 |
| InChI | InChI=1S/C15H15ClN4O4S/c1-8-10(14(22)19-15(17-8)25-2)4-6-13(21)18-9-3-5-11(16)12(7-9)20(23)24/h3,5,7H,4,6H2,1-2H3,(H,18,21)(H,17,19,22) |
| InChIKey | FWQRQNWXXJFKJZ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 117.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.83 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|