C25H17BrN4O2 — CID 137314364
8-bromo-6-[[(Z)-4-oxo-4-phenylbut-2-en-2-yl]diazenyl]-5H-indolo[2,1-b]quinazolin-12-one (PubChem CID 137314364) has the molecular formula C25H17BrN4O2 and a molecular weight of 485.34 g/mol. Its IUPAC name is 8-bromo-6-[[(Z)-4-oxo-4-phenylbut-2-en-2-yl]diazenyl]-5H-indolo[2,1-b]quinazolin-12-one.
| Compound Name | 8-bromo-6-[[(Z)-4-oxo-4-phenylbut-2-en-2-yl]diazenyl]-5H-indolo[2,1-b]quinazolin-12-one |
|---|---|
| PubChem CID | 137314364 |
| Molecular Formula | C25H17BrN4O2 |
| Molecular Weight | 485.34 g/mol |
| Exact Mass | 484.05 |
| IUPAC Name | 8-bromo-6-[[(Z)-4-oxo-4-phenylbut-2-en-2-yl]diazenyl]-5H-indolo[2,1-b]quinazolin-12-one |
| SMILES | CC(=C/C(=O)c1ccccc1)/N=N/c1c2cc(Br)ccc2n2c(=O)c3ccccc3[nH]c12 |
| InChI | InChI=1S/C25H17BrN4O2/c1-15(13-22(31)16-7-3-2-4-8-16)28-29-23-19-14-17(26)11-12-21(19)30-24(23)27-20-10-6-5-9-18(20)25(30)32/h2-14,27H,1H3/b15-13-,29-28+ |
| InChIKey | DOELMGKKLLOAKX-PJCCPENVSA-N |
| XLogP | 6.57 |
| TPSA | 79.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.34 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|