C21H16N4O2 — CID 137314423
6-[(3-oxocyclohexen-1-yl)diazenyl]-5H-indolo[2,1-b]quinazolin-12-one (PubChem CID 137314423) has the molecular formula C21H16N4O2 and a molecular weight of 356.38 g/mol. Its IUPAC name is 6-[(3-oxocyclohexen-1-yl)diazenyl]-5H-indolo[2,1-b]quinazolin-12-one.
| Compound Name | 6-[(3-oxocyclohexen-1-yl)diazenyl]-5H-indolo[2,1-b]quinazolin-12-one |
|---|---|
| PubChem CID | 137314423 |
| Molecular Formula | C21H16N4O2 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | 6-[(3-oxocyclohexen-1-yl)diazenyl]-5H-indolo[2,1-b]quinazolin-12-one |
| SMILES | O=C1C=C(/N=N/c2c3ccccc3n3c(=O)c4ccccc4[nH]c23)CCC1 |
| InChI | InChI=1S/C21H16N4O2/c26-14-7-5-6-13(12-14)23-24-19-16-9-2-4-11-18(16)25-20(19)22-17-10-3-1-8-15(17)21(25)27/h1-4,8-12,22H,5-7H2/b24-23+ |
| InChIKey | NAPXRDIHOITZOE-WCWDXBQESA-N |
| XLogP | 4.65 |
| TPSA | 79.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|