C29H32N4O2 — CID 137314948
2-[[(2S)-2-(dimethylamino)-3-(4-hydroxyphenyl)propyl]-prop-2-enylamino]-4-(naphthalen-2-ylmethyl)-1H-pyrimidin-6-one (PubChem CID 137314948) has the molecular formula C29H32N4O2 and a molecular weight of 468.60 g/mol. Its IUPAC name is 2-[[(2S)-2-(dimethylamino)-3-(4-hydroxyphenyl)propyl]-prop-2-enylamino]-4-(naphthalen-2-ylmethyl)-1H-pyrimidin-6-one.
| Compound Name | 2-[[(2S)-2-(dimethylamino)-3-(4-hydroxyphenyl)propyl]-prop-2-enylamino]-4-(naphthalen-2-ylmethyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 137314948 |
| Molecular Formula | C29H32N4O2 |
| Molecular Weight | 468.60 g/mol |
| Exact Mass | 468.25 |
| IUPAC Name | 2-[[(2S)-2-(dimethylamino)-3-(4-hydroxyphenyl)propyl]-prop-2-enylamino]-4-(naphthalen-2-ylmethyl)-1H-pyrimidin-6-one |
| SMILES | C=CCN(C[C@H](Cc1ccc(O)cc1)N(C)C)c1nc(Cc2ccc3ccccc3c2)cc(=O)[nH]1 |
| InChI | InChI=1S/C29H32N4O2/c1-4-15-33(20-26(32(2)3)18-21-10-13-27(34)14-11-21)29-30-25(19-28(35)31-29)17-22-9-12-23-7-5-6-8-24(23)16-22/h4-14,16,19,26,34H,1,15,17-18,20H2,2-3H3,(H,30,31,35)/t26-/m0/s1 |
| InChIKey | MJMCUXFVGFGUOI-SANMLTNESA-N |
| XLogP | 4.38 |
| TPSA | 72.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.60 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|