C27H38N8O2 — CID 137315505
4-tert-butyl-N-[(3R)-1-[5-[(5-methyl-1,3,3a,4,6,7-hexahydropyrazolo[1,5-a]pyrazin-2-ylidene)amino]-6-oxo-1H-pyridazin-3-yl]piperidin-3-yl]benzamide (PubChem CID 137315505) has the molecular formula C27H38N8O2 and a molecular weight of 506.66 g/mol. Its IUPAC name is 4-tert-butyl-N-[(3R)-1-[5-[(5-methyl-1,3,3a,4,6,7-hexahydropyrazolo[1,5-a]pyrazin-2-ylidene)amino]-6-oxo-1H-pyridazin-3-yl]piperidin-3-yl]benzamide.
| Compound Name | 4-tert-butyl-N-[(3R)-1-[5-[(5-methyl-1,3,3a,4,6,7-hexahydropyrazolo[1,5-a]pyrazin-2-ylidene)amino]-6-oxo-1H-pyridazin-3-yl]piperidin-3-yl]benzamide |
|---|---|
| PubChem CID | 137315505 |
| Molecular Formula | C27H38N8O2 |
| Molecular Weight | 506.66 g/mol |
| Exact Mass | 506.31 |
| IUPAC Name | 4-tert-butyl-N-[(3R)-1-[5-[(5-methyl-1,3,3a,4,6,7-hexahydropyrazolo[1,5-a]pyrazin-2-ylidene)amino]-6-oxo-1H-pyridazin-3-yl]piperidin-3-yl]benzamide |
| SMILES | CN1CCN2N/C(=N/c3cc(N4CCC[C@@H](NC(=O)c5ccc(C(C)(C)C)cc5)C4)n[nH]c3=O)CC2C1 |
| InChI | InChI=1S/C27H38N8O2/c1-27(2,3)19-9-7-18(8-10-19)25(36)28-20-6-5-11-34(16-20)24-15-22(26(37)31-30-24)29-23-14-21-17-33(4)12-13-35(21)32-23/h7-10,15,20-21H,5-6,11-14,16-17H2,1-4H3,(H,28,36)(H,31,37)(H,29,30,32)/t20-,21?/m1/s1 |
| InChIKey | GXZGAOHYMAXEJB-VQCQRNETSA-N |
| XLogP | 2.02 |
| TPSA | 108.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.66 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|