C18H19N5O — CID 137316030
(2E)-2-(4,6,8-trimethylquinazolin-2-yl)imino-4a,5,6,7-tetrahydrocyclopenta[d]pyrimidin-4-one (PubChem CID 137316030) has the molecular formula C18H19N5O and a molecular weight of 321.38 g/mol. Its IUPAC name is (2E)-2-(4,6,8-trimethylquinazolin-2-yl)imino-4a,5,6,7-tetrahydrocyclopenta[d]pyrimidin-4-one.
| Compound Name | (2E)-2-(4,6,8-trimethylquinazolin-2-yl)imino-4a,5,6,7-tetrahydrocyclopenta[d]pyrimidin-4-one |
|---|---|
| PubChem CID | 137316030 |
| Molecular Formula | C18H19N5O |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | (2E)-2-(4,6,8-trimethylquinazolin-2-yl)imino-4a,5,6,7-tetrahydrocyclopenta[d]pyrimidin-4-one |
| SMILES | Cc1cc(C)c2nc(/N=C3/N=C4CCCC4C(=O)N3)nc(C)c2c1 |
| InChI | InChI=1S/C18H19N5O/c1-9-7-10(2)15-13(8-9)11(3)19-17(21-15)23-18-20-14-6-4-5-12(14)16(24)22-18/h7-8,12H,4-6H2,1-3H3,(H,19,21,22,23,24) |
| InChIKey | JCFSAHFYEGDMOC-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 79.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|