C16H12F6N2O4 — CID 137316262
1-O-methyl 5-O-(2,2,2-trifluoroethyl) (3S)-4-diazo-2-methylidene-3-[4-(trifluoromethyl)phenyl]pentanedioate (PubChem CID 137316262) has the molecular formula C16H12F6N2O4 and a molecular weight of 410.27 g/mol. Its IUPAC name is 1-O-methyl 5-O-(2,2,2-trifluoroethyl) (3S)-4-diazo-2-methylidene-3-[4-(trifluoromethyl)phenyl]pentanedioate.
| Compound Name | 1-O-methyl 5-O-(2,2,2-trifluoroethyl) (3S)-4-diazo-2-methylidene-3-[4-(trifluoromethyl)phenyl]pentanedioate |
|---|---|
| PubChem CID | 137316262 |
| Molecular Formula | C16H12F6N2O4 |
| Molecular Weight | 410.27 g/mol |
| Exact Mass | 410.07 |
| IUPAC Name | 1-O-methyl 5-O-(2,2,2-trifluoroethyl) (3S)-4-diazo-2-methylidene-3-[4-(trifluoromethyl)phenyl]pentanedioate |
| SMILES | C=C(C(=O)OC)[C@@H](C(=[N+]=[N-])C(=O)OCC(F)(F)F)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H12F6N2O4/c1-8(13(25)27-2)11(9-3-5-10(6-4-9)16(20,21)22)12(24-23)14(26)28-7-15(17,18)19/h3-6,11H,1,7H2,2H3/t11-/m1/s1 |
| InChIKey | FSHWDRQFXBWNLU-LLVKDONJSA-N |
| XLogP | 3.29 |
| TPSA | 89.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.27 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|