C9H13N3O9P2S — CID 137319840
[(2R,4R,5R,6S)-10-imino-4-(phosphonooxymethyl)-3-oxa-7-thia-1,9-diazatricyclo[6.4.0.02,6]dodeca-8,11-dien-5-yl] dihydrogen phosphate (PubChem CID 137319840) has the molecular formula C9H13N3O9P2S and a molecular weight of 401.23 g/mol. Its IUPAC name is [(2R,4R,5R,6S)-10-imino-4-(phosphonooxymethyl)-3-oxa-7-thia-1,9-diazatricyclo[6.4.0.02,6]dodeca-8,11-dien-5-yl] dihydrogen phosphate.
| Compound Name | [(2R,4R,5R,6S)-10-imino-4-(phosphonooxymethyl)-3-oxa-7-thia-1,9-diazatricyclo[6.4.0.02,6]dodeca-8,11-dien-5-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 137319840 |
| Molecular Formula | C9H13N3O9P2S |
| Molecular Weight | 401.23 g/mol |
| Exact Mass | 400.98 |
| IUPAC Name | [(2R,4R,5R,6S)-10-imino-4-(phosphonooxymethyl)-3-oxa-7-thia-1,9-diazatricyclo[6.4.0.02,6]dodeca-8,11-dien-5-yl] dihydrogen phosphate |
| SMILES | [H]/N=c1\ccn2c(n1)S[C@H]1[C@H](OP(=O)(O)O)[C@@H](COP(=O)(O)O)O[C@H]12 |
| InChI | InChI=1S/C9H13N3O9P2S/c10-5-1-2-12-8-7(24-9(12)11-5)6(21-23(16,17)18)4(20-8)3-19-22(13,14)15/h1-2,4,6-8,10H,3H2,(H2,13,14,15)(H2,16,17,18)/b10-5+/t4-,6-,7+,8-/m1/s1 |
| InChIKey | OPHRVXUEGWRZJU-PJNBIRNISA-N |
| XLogP | -0.68 |
| TPSA | 184.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.23 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|