C26H50N4O8SSi2 — CID 137324412
(8R,9R)-9-[tert-butyl(dimethyl)silyl]oxy-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-8-[4-(diethoxymethyl)triazol-1-yl]-2,2-dioxo-1,7-dioxa-2λ6-thiaspiro[4.4]non-3-en-4-amine (PubChem CID 137324412) has the molecular formula C26H50N4O8SSi2 and a molecular weight of 634.95 g/mol. Its IUPAC name is (8R,9R)-9-[tert-butyl(dimethyl)silyl]oxy-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-8-[4-(diethoxymethyl)triazol-1-yl]-2,2-dioxo-1,7-dioxa-2λ6-thiaspiro[4.4]non-3-en-4-amine.
| Compound Name | (8R,9R)-9-[tert-butyl(dimethyl)silyl]oxy-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-8-[4-(diethoxymethyl)triazol-1-yl]-2,2-dioxo-1,7-dioxa-2λ6-thiaspiro[4.4]non-3-en-4-amine |
|---|---|
| PubChem CID | 137324412 |
| Molecular Formula | C26H50N4O8SSi2 |
| Molecular Weight | 634.95 g/mol |
| Exact Mass | 634.29 |
| IUPAC Name | (8R,9R)-9-[tert-butyl(dimethyl)silyl]oxy-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-8-[4-(diethoxymethyl)triazol-1-yl]-2,2-dioxo-1,7-dioxa-2λ6-thiaspiro[4.4]non-3-en-4-amine |
| SMILES | CCOC(OCC)c1cn([C@@H]2OC(CO[Si](C)(C)C(C)(C)C)C3(OS(=O)(=O)C=C3N)[C@H]2O[Si](C)(C)C(C)(C)C)nn1 |
| InChI | InChI=1S/C26H50N4O8SSi2/c1-13-33-23(34-14-2)18-15-30(29-28-18)22-21(37-41(11,12)25(6,7)8)26(19(27)17-39(31,32)38-26)20(36-22)16-35-40(9,10)24(3,4)5/h15,17,20-23H,13-14,16,27H2,1-12H3/t20?,21-,22+,26?/m0/s1 |
| InChIKey | JRICRVXBKBZSOA-LMGFAJPXSA-N |
| XLogP | 4.56 |
| TPSA | 146.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.95 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|