C23H39N3O8SSi — CID 137322161
1-[(8R,9R)-4-amino-9-[tert-butyl(dimethyl)silyl]oxy-6-(2-methylpropoxymethyl)-2,2-dioxo-1,7-dioxa-2λ6-thiaspiro[4.4]non-3-en-8-yl]-3,5-dimethylpyrimidine-2,4-dione (PubChem CID 137322161) has the molecular formula C23H39N3O8SSi and a molecular weight of 545.73 g/mol. Its IUPAC name is 1-[(8R,9R)-4-amino-9-[tert-butyl(dimethyl)silyl]oxy-6-(2-methylpropoxymethyl)-2,2-dioxo-1,7-dioxa-2λ6-thiaspiro[4.4]non-3-en-8-yl]-3,5-dimethylpyrimidine-2,4-dione.
| Compound Name | 1-[(8R,9R)-4-amino-9-[tert-butyl(dimethyl)silyl]oxy-6-(2-methylpropoxymethyl)-2,2-dioxo-1,7-dioxa-2λ6-thiaspiro[4.4]non-3-en-8-yl]-3,5-dimethylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 137322161 |
| Molecular Formula | C23H39N3O8SSi |
| Molecular Weight | 545.73 g/mol |
| Exact Mass | 545.22 |
| IUPAC Name | 1-[(8R,9R)-4-amino-9-[tert-butyl(dimethyl)silyl]oxy-6-(2-methylpropoxymethyl)-2,2-dioxo-1,7-dioxa-2λ6-thiaspiro[4.4]non-3-en-8-yl]-3,5-dimethylpyrimidine-2,4-dione |
| SMILES | Cc1cn([C@@H]2OC(COCC(C)C)C3(OS(=O)(=O)C=C3N)[C@H]2O[Si](C)(C)C(C)(C)C)c(=O)n(C)c1=O |
| InChI | InChI=1S/C23H39N3O8SSi/c1-14(2)11-31-12-17-23(16(24)13-35(29,30)34-23)18(33-36(8,9)22(4,5)6)20(32-17)26-10-15(3)19(27)25(7)21(26)28/h10,13-14,17-18,20H,11-12,24H2,1-9H3/t17?,18-,20+,23?/m0/s1 |
| InChIKey | BYTNJWGXWGHQOU-MCGOBGFWSA-N |
| XLogP | 1.71 |
| TPSA | 141.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.73 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|