C25H44N4O7Si2 — CID 137323213
1-[(8R,9R)-4-amino-9-[tert-butyl(dimethyl)silyl]oxy-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-oxo-1,7-dioxa-3-azaspiro[4.4]non-3-en-8-yl]-3,5-dimethylpyrimidine-2,4-dione (PubChem CID 137323213) has the molecular formula C25H44N4O7Si2 and a molecular weight of 568.82 g/mol. Its IUPAC name is 1-[(8R,9R)-4-amino-9-[tert-butyl(dimethyl)silyl]oxy-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-oxo-1,7-dioxa-3-azaspiro[4.4]non-3-en-8-yl]-3,5-dimethylpyrimidine-2,4-dione.
| Compound Name | 1-[(8R,9R)-4-amino-9-[tert-butyl(dimethyl)silyl]oxy-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-oxo-1,7-dioxa-3-azaspiro[4.4]non-3-en-8-yl]-3,5-dimethylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 137323213 |
| Molecular Formula | C25H44N4O7Si2 |
| Molecular Weight | 568.82 g/mol |
| Exact Mass | 568.27 |
| IUPAC Name | 1-[(8R,9R)-4-amino-9-[tert-butyl(dimethyl)silyl]oxy-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-oxo-1,7-dioxa-3-azaspiro[4.4]non-3-en-8-yl]-3,5-dimethylpyrimidine-2,4-dione |
| SMILES | Cc1cn([C@@H]2OC(CO[Si](C)(C)C(C)(C)C)C3(OC(=O)N=C3N)[C@H]2O[Si](C)(C)C(C)(C)C)c(=O)n(C)c1=O |
| InChI | InChI=1S/C25H44N4O7Si2/c1-15-13-29(22(32)28(8)18(15)30)19-17(36-38(11,12)24(5,6)7)25(20(26)27-21(31)35-25)16(34-19)14-33-37(9,10)23(2,3)4/h13,16-17,19H,14H2,1-12H3,(H2,26,27,31)/t16?,17-,19+,25?/m0/s1 |
| InChIKey | QPMMAJWLXWPKMF-YUZDLGMYSA-N |
| XLogP | 3.41 |
| TPSA | 136.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.82 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|