C30H51N3O2Si — CID 137328068
2,5-dimethylnonyl-[6-[5-(4-hexoxybutyl)-2-pyridinyl]pyrazin-2-yl]oxysilane (PubChem CID 137328068) has the molecular formula C30H51N3O2Si and a molecular weight of 513.84 g/mol. Its IUPAC name is 2,5-dimethylnonyl-[6-[5-(4-hexoxybutyl)-2-pyridinyl]pyrazin-2-yl]oxysilane.
| Compound Name | 2,5-dimethylnonyl-[6-[5-(4-hexoxybutyl)-2-pyridinyl]pyrazin-2-yl]oxysilane |
|---|---|
| PubChem CID | 137328068 |
| Molecular Formula | C30H51N3O2Si |
| Molecular Weight | 513.84 g/mol |
| Exact Mass | 513.38 |
| IUPAC Name | 2,5-dimethylnonyl-[6-[5-(4-hexoxybutyl)-2-pyridinyl]pyrazin-2-yl]oxysilane |
| SMILES | CCCCCCOCCCCc1ccc(-c2cncc(O[SiH2]CC(C)CCC(C)CCCC)n2)nc1 |
| InChI | InChI=1S/C30H51N3O2Si/c1-5-7-9-11-19-34-20-12-10-14-27-17-18-28(32-21-27)29-22-31-23-30(33-29)35-36-24-26(4)16-15-25(3)13-8-6-2/h17-18,21-23,25-26H,5-16,19-20,24,36H2,1-4H3 |
| InChIKey | IPBDTWPIHIFSGS-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 57.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.84 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|