C33H50ClF3NO7PSi — CID 137328782
tert-butyl N-[4-tert-butyl-7-[2-chloro-4-[3-(trifluoromethyl)phenoxy]phenyl]-2-dimethoxyphosphoryl-2,3-dimethyl-1-silyloxyheptan-4-yl]carbamate (PubChem CID 137328782) has the molecular formula C33H50ClF3NO7PSi and a molecular weight of 724.27 g/mol. Its IUPAC name is tert-butyl N-[4-tert-butyl-7-[2-chloro-4-[3-(trifluoromethyl)phenoxy]phenyl]-2-dimethoxyphosphoryl-2,3-dimethyl-1-silyloxyheptan-4-yl]carbamate.
| Compound Name | tert-butyl N-[4-tert-butyl-7-[2-chloro-4-[3-(trifluoromethyl)phenoxy]phenyl]-2-dimethoxyphosphoryl-2,3-dimethyl-1-silyloxyheptan-4-yl]carbamate |
|---|---|
| PubChem CID | 137328782 |
| Molecular Formula | C33H50ClF3NO7PSi |
| Molecular Weight | 724.27 g/mol |
| Exact Mass | 723.27 |
| IUPAC Name | tert-butyl N-[4-tert-butyl-7-[2-chloro-4-[3-(trifluoromethyl)phenoxy]phenyl]-2-dimethoxyphosphoryl-2,3-dimethyl-1-silyloxyheptan-4-yl]carbamate |
| SMILES | COP(=O)(OC)C(C)(CO[SiH3])C(C)C(CCCc1ccc(Oc2cccc(C(F)(F)F)c2)cc1Cl)(NC(=O)OC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C33H50ClF3NO7PSi/c1-22(31(8,21-43-47)46(40,41-9)42-10)32(29(2,3)4,38-28(39)45-30(5,6)7)18-12-13-23-16-17-26(20-27(23)34)44-25-15-11-14-24(19-25)33(35,36)37/h11,14-17,19-20,22H,12-13,18,21H2,1-10,47H3,(H,38,39) |
| InChIKey | YBTQWOXABVNXCY-UHFFFAOYSA-N |
| XLogP | 8.96 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.27 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|